| Product Name | 2-Fluorobenzoic hydrazide |
| CAS No. | 446-24-2 |
| Synonyms | 2-Fluorobenzhydrazide; 2-fluorobenzohydrazide |
| InChI | InChI=1/C7H7FN2O/c8-6-4-2-1-3-5(6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| Molecular Formula | C7H7FN2O |
| Molecular Weight | 154.1417 |
| Density | 1.272g/cm3 |
| Melting point | 70-74℃ |
| Boiling point | 309.1°C at 760 mmHg |
| Flash point | 140.7°C |
| Refractive index | 1.552 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
446-24-2 2-fluorobenzoic hydrazide
service@apichina.com