| Product Name | 2-fluoro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylic acid |
| CAS No. | 1555-11-9 |
| InChI | InChI=1/C15H14FNO2/c16-9-6-7-13-11(8-9)14(15(18)19)10-4-2-1-3-5-12(10)17-13/h6-8H,1-5H2,(H,18,19) |
| Molecular Formula | C15H14FNO2 |
| Molecular Weight | 259.2756 |
| Density | 1.308g/cm3 |
| Melting point | 200℃ |
| Boiling point | 435.2°C at 760 mmHg |
| Flash point | 217°C |
| Refractive index | 1.63 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1555-11-9 2-fluoro-7,8,9,10-tetrahydro-6h-cyclohepta[b]quinoline-11-carboxylic acid
service@apichina.com