| Product Name | 2-Fluoro-6-phenoxybenzonitrile |
| CAS No. | 175204-06-5 |
| Synonyms | 2-Fluoro-6-phenyloxybenzonitrile |
| InChI | InChI=1/C13H8FNO/c14-12-7-4-8-13(11(12)9-15)16-10-5-2-1-3-6-10/h1-8H |
| Molecular Formula | C13H8FNO |
| Molecular Weight | 213.2071 |
| Density | 1.24g/cm3 |
| Melting point | 90-93℃ |
| Boiling point | 308.5°C at 760 mmHg |
| Flash point | 140.4°C |
| Refractive index | 1.591 |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
175204-06-5 2-fluoro-6-phenoxybenzonitrile
service@apichina.com