| Product Name | 2-fluoro-6-nitrophenol |
| CAS No. | 1526-17-6 |
| Synonyms | 2-nitro-6-fluorophenol; Phenol, 2-fluoro-6-nitro- |
| InChI | InChI=1/C6H4FNO3/c7-4-2-1-3-5(6(4)9)8(10)11/h1-3,9H |
| Molecular Formula | C6H4FNO3 |
| Molecular Weight | 157.1 |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
1526-17-6 2-fluoro-6-nitrophenol
service@apichina.com