| Product Name | 2-fluoro-6-nitrobenzyl bromide |
| CAS No. | 1958-93-6 |
| Synonyms | 2-Bromomethyl-1-fluoro-3-nitrobenzene; 2-(Bromomethyl)-1-fluoro-3-nitrobenzene |
| InChI | InChI=1/C7H5BrFNO2/c8-4-5-6(9)2-1-3-7(5)10(11)12/h1-3H,4H2 |
| Molecular Formula | C7H5BrFNO2 |
| Molecular Weight | 234.0225 |
| Density | 1.733g/cm3 |
| Boiling point | 275.5°C at 760 mmHg |
| Flash point | 120.4°C |
| Refractive index | 1.588 |
| Risk Codes | R34:Causes burns.; R36/37:Irritating to eyes and respiratory system.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1958-93-6 2-fluoro-6-nitrobenzyl bromide
service@apichina.com