| Product Name | 2-fluoro-6-methylnaphthalene |
| CAS No. | 324-42-5 |
| InChI | InChI=1/C11H9F/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-7H,1H3 |
| Molecular Formula | C11H9F |
| Molecular Weight | 160.1876 |
| Density | 1.112g/cm3 |
| Melting point | 72℃ |
| Boiling point | 247.5°C at 760 mmHg |
| Flash point | 84.5°C |
| Refractive index | 1.594 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
324-42-5 2-fluoro-6-methylnaphthalene
service@apichina.com