| Product Name | 2-Fluoro-6-hydroxybenzonitrile |
| CAS No. | 140675-43-0 |
| Synonyms | 2-Cyano-3-fluorophenol; 2-fluoro-6-hydroxybenzonitrle |
| InChI | InChI=1/C8H5FO/c1-2-6-7(9)4-3-5-8(6)10/h1,3-5,10H |
| Molecular Formula | C8H5FO |
| Molecular Weight | 136.1231 |
| Refractive index | 1.56 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
140675-43-0 2-fluoro-6-hydroxybenzonitrile
service@apichina.com