| Product Name | 2-Fluoro-4-methoxybenzeneboronic acid |
| CAS No. | 162101-31-7 |
| Synonyms | 2-Fluoro-4-methoxyphenylboronic acid; Fluoro-4-methoxyphenylboronic acid |
| InChI | InChI=1/C7H8BFO3/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4,10-11H,1H3 |
| Molecular Formula | C7H8BFO3 |
| Molecular Weight | 169.946 |
| Density | 1.265g/cm3 |
| Boiling point | 291.169°C at 760 mmHg |
| Flash point | 129.895°C |
| Refractive index | 1.504 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
162101-31-7 2-fluoro-4-methoxybenzeneboronic acid
service@apichina.com