| Product Name | 2-(Ethylthio)nicotinic acid |
| CAS No. | 27868-76-4 |
| Synonyms | 2-(Ethylmercapto)nicotinic acid~2-(Ethylthio)pyridine-3-carboxylic acid; 2-(ethylsulfanyl)pyridine-3-carboxylic acid |
| InChI | InChI=1/C8H9NO2S/c1-2-12-7-6(8(10)11)4-3-5-9-7/h3-5H,2H2,1H3,(H,10,11) |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.2276 |
| Density | 1.3g/cm3 |
| Melting point | 185-187℃ |
| Boiling point | 338.6°C at 760 mmHg |
| Flash point | 158.6°C |
| Refractive index | 1.599 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
27868-76-4 2-(ethylthio)nicotinic acid
service@apichina.com