| Product Name | 2-ethylhexanoic acid, compound with N-(2-aminoethyl)ethane-1,2-diamine |
| CAS No. | 63428-89-7 |
| Synonyms | Hexanoic acid, 2-ethyl-, compd. with N1-(2-aminoethyl)-1,2-ethanediamine (1:?); 2-Ethylhexanoic acid, compound with N-(2-aminoethyl)ethane-1,2-diamine; Hexanoic acid, 2-ethyl-, compd. with N-(2-aminoethyl)-1,2-ethanediamine; 2-ethylhexanoic acid - N-(2-aminoethyl)ethane-1,2-diamine (1:1) |
| InChI | InChI=1/C8H16O2.C4H13N3/c1-3-5-6-7(4-2)8(9)10;5-1-3-7-4-2-6/h7H,3-6H2,1-2H3,(H,9,10);7H,1-6H2 |
| Molecular Formula | C12H29N3O2 |
| Molecular Weight | 247.3776 |
| Boiling point | 228°C at 760 mmHg |
| Flash point | 116.6°C |
63428-89-7 2-ethylhexanoic acid, compound with n-(2-aminoethyl)ethane-1,2-diamine
service@apichina.com