| Product Name | 2-Ethylbutanal |
| CAS No. | 97-96-1 |
| Synonyms | Butanal, 2-ethyl-; 2-Ethylbutyraldehyde; 2-Ethylbutyric aldehyde; 2-Ethylbutyric aledhyde; 3-Formylpentane; 4-01-00-03310 (Beilstein Handbook Reference); Aldehyde 2-ethylbutyrique; Aldehyde 2-ethylbutyrique [French]; BRN 1209330; Butyraldehyde, 2-ethyl-; Diethyl acetaldehyde; Diethylacetaldehyde; Ethyl butyraldehyde; FEMA No. 2426; NSC 6757; alpha-Ethylbutanal; alpha-Ethylbutyraldehyde; 2-Ethylbutyraldehyde [UN1178] [Flammable liquid]; UN1178 |
| InChI | InChI=1/C6H12O/c1-3-6(4-2)5-7/h5-6H,3-4H2,1-2H3 |
| Molecular Formula | C6H12O |
| Molecular Weight | 100.1589 |
| Density | 0.799g/cm3 |
| Boiling point | 118.1°C at 760 mmHg |
| Flash point | 21.1°C |
| Refractive index | 1.394 |
| Hazard Symbols |  F:Highly flammable;  Xi:Irritant; |
| Risk Codes | R11:Highly flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S24/25:Avoid contact with skin and eyes.; |
97-96-1 2-ethylbutanal
service@apichina.com