| Product Name | 2-Ethylbenzeneboronic acid |
| CAS No. | 90002-36-1 |
| Synonyms | 2-Ethylphenylboronic acid; RNase A |
| InChI | InChI=1/C8H11BO2/c1-2-7-5-3-4-6-8(7)9(10)11/h3-6,10-11H,2H2,1H3 |
| Molecular Formula | C8H11BO2 |
| Molecular Weight | 149.9827 |
| Density | 1.07g/cm3 |
| Melting point | 102.5-107.5℃ |
| Boiling point | 299.1°C at 760 mmHg |
| Flash point | 134.7°C |
| Refractive index | 1.521 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
90002-36-1 2-ethylbenzeneboronic acid
service@apichina.com