| Product Name | 2-Ethyl-6-methylpyridine |
| CAS No. | 1122-69-6 |
| InChI | InChI=1/C8H11N/c1-3-8-6-4-5-7(2)9-8/h4-6H,3H2,1-2H3 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.1796 |
| Density | 0.919g/cm3 |
| Boiling point | 157.9°C at 760 mmHg |
| Flash point | 43.4°C |
| Refractive index | 1.499 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
1122-69-6 2-ethyl-6-methylpyridine
service@apichina.com