| Product Name | 2-ethoxyphenyl isothiocyanate |
| CAS No. | 23163-84-0 |
| Synonyms | o-Ethoxyphenyl isothiocyanate; 1-ethoxy-2-isothiocyanatobenzene |
| InChI | InChI=1/C9H9NOS/c1-2-11-9-6-4-3-5-8(9)10-7-12/h3-6H,2H2,1H3 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.2389 |
| Density | 1.06g/cm3 |
| Boiling point | 293.2°C at 760 mmHg |
| Flash point | 131.1°C |
| Refractive index | 1.544 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
23163-84-0 2-ethoxyphenyl isothiocyanate
service@apichina.com