| Product Name | 2-(ethoxycarbonyl)-3-propylhexanoic acid |
| CAS No. | 255714-16-0 |
| InChI | InChI=1/C12H22O4/c1-4-7-9(8-5-2)10(11(13)14)12(15)16-6-3/h9-10H,4-8H2,1-3H3,(H,13,14) |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.3007 |
| Density | 1.021g/cm3 |
| Melting point | 30℃ |
| Boiling point | 331.9°C at 760 mmHg |
| Flash point | 117°C |
| Refractive index | 1.452 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
255714-16-0 2-(ethoxycarbonyl)-3-propylhexanoic acid
service@apichina.com