| Product Name | 2-dimethylamino-6-fluorobenzonitrile |
| CAS No. | 96994-73-9 |
| InChI | InChI=1/C9H9FN2/c1-12(2)9-5-3-4-8(10)7(9)6-11/h3-5H,1-2H3 |
| Molecular Formula | C9H9FN2 |
| Molecular Weight | 164.1796 |
| Density | 1.13g/cm3 |
| Boiling point | 267.4°C at 760 mmHg |
| Flash point | 115.5°C |
| Refractive index | 1.53 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
96994-73-9 2-dimethylamino-6-fluorobenzonitrile
service@apichina.com