| Product Name | 2-(Difluoromethylthio)benzoic acid |
| CAS No. | 79676-56-5 |
| Synonyms | 2-[(difluoromethyl)sulfanyl]benzoate; 2-[(difluoromethyl)sulfanyl]benzoic acid; 2-[(difluoromethyl)sulfanyl]benzoyl chloride |
| InChI | InChI=1/C8H5ClF2OS/c9-7(12)5-3-1-2-4-6(5)13-8(10)11/h1-4,8H |
| Molecular Formula | C8H5ClF2OS |
| Molecular Weight | 222.6395 |
| Density | 1.42g/cm3 |
| Boiling point | 236.2°C at 760 mmHg |
| Flash point | 96.6°C |
| Refractive index | 1.541 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
79676-56-5 2-(difluoromethylthio)benzoic acid
service@apichina.com