| Sales Email | Service@apichina.com |
| CAS No. | 22225-77-0 |
| Product Name | 2-(difluoromethoxy)nitrobenzene |
| Synonyms | 1-(Difluoromethoxy)-2-nitrobenzene |
| InChI | InChI=1/C7H5F2NO3/c8-7(9)13-6-4-2-1-3-5(6)10(11)12/h1-4,7H |
| Molecular Formula | C7H5F2NO3 |
| Molecular Weight | 189.1163 |
| Density | 1.384g/cm3 |
| Boiling point | 249.4°C at 760 mmHg |
| Flash point | 104.6°C |
| Refractive index | 1.494 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
