| Product Name | 2-(difluoromethoxy)benzyl bromide |
| CAS No. | 85684-64-6 |
| Synonyms | alpha-Bromo-2-difluoromethoxytoluene; 1-(bromomethyl)-2-(difluoromethoxy)benzene |
| InChI | InChI=1/C8H7BrF2O/c9-5-6-3-1-2-4-7(6)12-8(10)11/h1-4,8H,5H2 |
| Molecular Formula | C8H7BrF2O |
| Molecular Weight | 237.0414 |
| Density | 1.537g/cm3 |
| Boiling point | 225.2°C at 760 mmHg |
| Flash point | 108.9°C |
| Refractive index | 1.506 |
| Risk Codes | R34:Causes burns.; R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
85684-64-6 2-(difluoromethoxy)benzyl bromide
service@apichina.com