| Product Name | 2-(Difluoromethoxy)benzoic acid |
| CAS No. | 97914-59-5 |
| Synonyms | 2-(Difluorometoxy)benzoic acid; 2-(difluoromethoxy)benzoate |
| InChI | InChI=1/C8H6F2O3/c9-8(10)13-6-4-2-1-3-5(6)7(11)12/h1-4,8H,(H,11,12) |
| Molecular Formula | C8H6F2O3 |
| Molecular Weight | 188.1282 |
| Density | 1.37g/cm3 |
| Boiling point | 273.6°C at 760 mmHg |
| Flash point | 119.3°C |
| Refractive index | 1.496 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
97914-59-5 2-(difluoromethoxy)benzoic acid
service@apichina.com