| Product Name | 2-(difluoromethoxy)aniline |
| CAS No. | 22236-04-0 |
| Synonyms | 2-Difluoromethoxyaniline |
| InChI | InChI=1/C7H7F2NO/c8-7(9)11-6-4-2-1-3-5(6)10/h1-4,7H,10H2 |
| Molecular Formula | C7H7F2NO |
| Molecular Weight | 159.1334 |
| Density | 1.253g/cm3 |
| Boiling point | 209.8°C at 760 mmHg |
| Flash point | 80.7°C |
| Refractive index | 1.501 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
22236-04-0 2-(difluoromethoxy)aniline
service@apichina.com