| Sales Email | Service@apichina.com |
| CAS No. | 4832-17-1 |
| Product Name | 2-Decalone, mixture of cis and trans |
| Synonyms | 2-Decalone,mixture of cis and trans; bicyclo(4.4.0)decan-2-one; octahydronaphthalen-2(1H)-one |
| InChI | InChI=1/C10H16O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h8-9H,1-7H2 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.2334 |
| Density | 0.982g/cm3 |
| Boiling point | 255°C at 760 mmHg |
| Flash point | 101.7°C |
| Refractive index | 1.483 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
