| Product Name | 2-Cyclohexylbenzoic acid |
| CAS No. | 97023-48-8 |
| InChI | InChI=1/C13H16O2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2,(H,14,15) |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.2649 |
| Density | 1.115g/cm3 |
| Boiling point | 332.4°C at 760 mmHg |
| Flash point | 156.8°C |
| Refractive index | 1.557 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
97023-48-8 2-cyclohexylbenzoic acid
service@apichina.com