| Product Name | 2-Cyano-4-methylpyridine |
| CAS No. | 1620-76-4 |
| Synonyms | 2-Cyano-4-picoline; 4-Methylpicolinonitrile; 4-Methyl-2-pyridinecarbonitrile; 4-methylpyridine-2-carbonitrile |
| InChI | InChI=1/C7H6N2/c1-6-2-3-9-7(4-6)5-8/h2-4H,1H3 |
| Molecular Formula | C7H6N2 |
| Molecular Weight | 118.1359 |
| Density | 1.08g/cm3 |
| Boiling point | 261.1°C at 760 mmHg |
| Flash point | 99.9°C |
| Refractive index | 1.531 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
1620-76-4 2-cyano-4-methylpyridine
service@apichina.com