| Sales Email | Service@apichina.com |
| CAS No. | 2402-95-1 |
| Product Name | 2-Chloropyridine-N-Oxide |
| Synonyms | 2-Chloropyridine N-oxide; 2-chloro-3-fluoropyridine 1-oxide |
| InChI | InChI=1/C5H3ClFNO/c6-5-4(7)2-1-3-8(5)9/h1-3H |
| Molecular Formula | C5H3ClFNO |
| Molecular Weight | 147.5348 |
| Density | 1.41g/cm3 |
| Boiling point | 317.1°C at 760 mmHg |
| Flash point | 145.6°C |
| Refractive index | 1.53 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
