| Product Name | 2-Chlorophenoxyacetic acid hydrazide |
| CAS No. | 36304-40-2 |
| Synonyms | ASISCHEM U30989; AKOS BBB/158; 2-Chlorophenoxyacetic acid hydrazide 98%; 2-(2-chlorophenoxy)acetohydrazide |
| InChI | InChI=1/C8H9ClN2O2/c9-6-3-1-2-4-7(6)13-5-8(12)11-10/h1-4H,5,10H2,(H,11,12) |
| Molecular Formula | C8H9ClN2O2 |
| Molecular Weight | 200.6223 |
| Density | 1.324g/cm3 |
| Boiling point | 419.8°C at 760 mmHg |
| Flash point | 207.7°C |
| Refractive index | 1.568 |
| Hazard Symbols |  Xi:; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
36304-40-2 2-chlorophenoxyacetic acid hydrazide
service@apichina.com