| Product Name | 2-Chloromethyl-3,5-dimethyl-4-methoxypyridine |
| CAS No. | 84006-10-0 |
| Synonyms | 2-(chloromethyl)-4-methoxy-3,5-dimethylpyridine; 2-(Chloromethyl)-3,5-dimethyl-4-methoxypyridine; 2-(chloromethyl)-4-methoxy-3,5-dimethylpyridine hydrochloride (1:1) |
| InChI | InChI=1/C9H12ClNO.ClH/c1-6-5-11-8(4-10)7(2)9(6)12-3;/h5H,4H2,1-3H3;1H |
| Molecular Formula | C9H13Cl2NO |
| Molecular Weight | 222.1116 |
| Boiling point | 272.2°C at 760 mmHg |
| Flash point | 118.4°C |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
84006-10-0 2-chloromethyl-3,5-dimethyl-4-methoxypyridine
service@apichina.com