| Product Name | 2-(chloromethyl)-1-methyl-1H-imidazole hydrochloride |
| CAS No. | 78667-04-6 |
| InChI | InChI=1/C5H7ClN2.ClH/c1-8-3-2-7-5(8)4-6;/h2-3H,4H2,1H3;1H |
| Molecular Formula | C5H8Cl2N2 |
| Molecular Weight | 167.0364 |
| Melting point | 150℃ |
| Boiling point | 243.7°C at 760 mmHg |
| Flash point | 101.2°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
78667-04-6 2-(chloromethyl)-1-methyl-1h-imidazole hydrochloride
service@apichina.com