| Product Name | 2-Chloroethyl phenyl sulphoxide |
| CAS No. | 27998-60-3 |
| Synonyms | 2-Chloroethyl phenyl sulfoxide; [(2-chloroethyl)sulfinyl]benzene |
| InChI | InChI=1/C8H9ClOS/c9-6-7-11(10)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| Molecular Formula | C8H9ClOS |
| Molecular Weight | 188.6745 |
| Density | 1.3g/cm3 |
| Boiling point | 330.6°C at 760 mmHg |
| Flash point | 153.7°C |
| Refractive index | 1.601 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
27998-60-3 2-chloroethyl phenyl sulphoxide
service@apichina.com