| Product Name | 2-Chloroethyl methacrylate |
| CAS No. | 1888-94-4 |
| Synonyms | Methacrylic acid 2-chloroethyl ester; 2-chloroethyl 2-methylprop-2-enoate |
| InChI | InChI=1/C6H9ClO2/c1-5(2)6(8)9-4-3-7/h1,3-4H2,2H3 |
| Molecular Formula | C6H9ClO2 |
| Molecular Weight | 148.5875 |
| Density | 1.081g/cm3 |
| Boiling point | 185.6°C at 760 mmHg |
| Flash point | 75.3°C |
| Refractive index | 1.437 |
| Risk Codes | R23/25:Toxic by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
1888-94-4 2-chloroethyl methacrylate
service@apichina.com