| Product Name | 2-Chlorobutyryl chloride |
| CAS No. | 7623-11-2 |
| Synonyms | 2-Chlorobutyryl chloride; 2-chlorobutanoyl chloride |
| InChI | InChI=1/C4H6Cl2O/c1-2-3(5)4(6)7/h3H,2H2,1H3 |
| Molecular Formula | C4H6Cl2O |
| Molecular Weight | 140.9958 |
| Density | 1.227g/cm3 |
| Boiling point | 130.5°C at 760 mmHg |
| Flash point | 53.2°C |
| Refractive index | 1.44 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
7623-11-2 2-chlorobutyryl chloride
service@apichina.com