| Product Name | 2-Chlorobutyramide |
| CAS No. | 7462-73-9 |
| Synonyms | 2-chlorobutanamide; (2R)-2-chlorobutanamide |
| InChI | InChI=1/C4H8ClNO/c1-2-3(5)4(6)7/h3H,2H2,1H3,(H2,6,7)/t3-/m1/s1 |
| Molecular Formula | C4H8ClNO |
| Molecular Weight | 121.5654 |
| Density | 1.134g/cm3 |
| Boiling point | 247.9°C at 760 mmHg |
| Flash point | 103.7°C |
| Refractive index | 1.452 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
7462-73-9 2-chlorobutyramide
service@apichina.com