| Product Name | 2-Chlorobenzyl isothiocyanate |
| CAS No. | 18967-44-7 |
| Synonyms | Isothiocyanic acid, o-chlorobenzyl ester; 4-12-00-02362 (Beilstein Handbook Reference); BRN 2936688; NSC 221237; Benzene, 1-chloro-2-(isothiocyanatomethyl)- (9CI); 1-chloro-2-(isothiocyanatomethyl)benzene |
| InChI | InChI=1/C8H6ClNS/c9-8-4-2-1-3-7(8)5-10-6-11/h1-4H,5H2 |
| Molecular Formula | C8H6ClNS |
| Molecular Weight | 183.6579 |
| Density | 1.18g/cm3 |
| Boiling point | 278.7°C at 760 mmHg |
| Flash point | 122.4°C |
| Refractive index | 1.581 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
18967-44-7 2-chlorobenzyl isothiocyanate
service@apichina.com