| Product Name | 2-Chloroanthracene |
| CAS No. | 17135-78-3 |
| Synonyms | Anthracene, 2-chloro-; 4-05-00-02292 (Beilstein Handbook Reference); AI3-23450; BRN 2047055; CCRIS 5549; NSC 408454 |
| InChI | InChI=1/C14H9Cl/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H |
| Molecular Formula | C14H9Cl |
| Molecular Weight | 212.6743 |
| Density | 1.253g/cm3 |
| Melting point | 221-223℃ |
| Boiling point | 370.1°C at 760 mmHg |
| Flash point | 179.2°C |
| Refractive index | 1.717 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
17135-78-3 2-chloroanthracene
service@apichina.com