| Product Name | 2-Chloro-N-methoxy-N-methylacetamide |
| CAS No. | 67442-07-3 |
| Synonyms | Acetamide, 2-chloro-N-methoxy-N-methyl-; N-Methyl-N-methoxy-2-chloroacetamide |
| InChI | InChI=1/C4H8ClNO2/c1-6(8-2)4(7)3-5/h3H2,1-2H3 |
| Molecular Formula | C4H8ClNO2 |
| Molecular Weight | 137.5648 |
| Density | 1.178g/cm3 |
| Melting point | 39-41℃ |
| Boiling point | 141.5°C at 760 mmHg |
| Flash point | 39.4°C |
| Refractive index | 1.442 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
67442-07-3 2-chloro-n-methoxy-n-methylacetamide
service@apichina.com