| Product Name | 2-Chloro-N-(2,6-diethylphenyl)-acetamide |
| CAS No. | 6967-29-9 |
| Synonyms | N-Chloroacetyl-2,6-diethylaniline; alpha-Chloro-2,6-diethylacetanilide |
| InChI | InChI=1/C12H16ClNO/c1-3-9-6-5-7-10(4-2)12(9)14-11(15)8-13/h5-7H,3-4,8H2,1-2H3,(H,14,15) |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.7145 |
| Density | 1.131g/cm3 |
| Boiling point | 369.2°C at 760 mmHg |
| Flash point | 177.1°C |
| Refractive index | 1.559 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6967-29-9 2-chloro-n-(2,6-diethylphenyl)-acetamide
service@apichina.com