| Product Name | 2-Chloro-N-(2,6-dichlorophenyl)-acetamide |
| CAS No. | 3644-56-2 |
| Synonyms | 2-Chloro-N-(2,6-dichlorophenyl)acetamide |
| InChI | InChI=1/C8H6Cl3NO/c9-4-7(13)12-8-5(10)2-1-3-6(8)11/h1-3H,4H2,(H,12,13) |
| Molecular Formula | C8H6Cl3NO |
| Molecular Weight | 238.4983 |
| Density | 1.511g/cm3 |
| Melting point | 176-179℃ |
| Boiling point | 376.2°C at 760 mmHg |
| Flash point | 181.3°C |
| Refractive index | 1.616 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28A:After contact with skin, wash immediately with plenty of water.; |
3644-56-2 2-chloro-n-(2,6-dichlorophenyl)-acetamide
service@apichina.com