| Product Name | 2-Chloro isonicotinamide |
| CAS No. | 100859-84-5 |
| Synonyms | 6-methyl-5-nitropyridin-2(1H)-one; 2-chloropyridine-4-carboxamide |
| InChI | InChI=1/C6H5ClN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
| Molecular Formula | C6H5ClN2O |
| Molecular Weight | 156.5697 |
| Density | 1.381g/cm3 |
| Melting point | 193℃ |
| Boiling point | 312.2°C at 760 mmHg |
| Flash point | 142.6°C |
| Refractive index | 1.588 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
100859-84-5 2-chloro isonicotinamide
service@apichina.com