| Product Name | 2-Chloro-6-methylthiophenol |
| CAS No. | 18858-05-4 |
| Synonyms | 2-Chloro-6-methylbenzenethiol |
| InChI | InChI=1/C7H7ClS/c1-5-3-2-4-6(8)7(5)9/h2-4,9H,1H3 |
| Molecular Formula | C7H7ClS |
| Molecular Weight | 158.6485 |
| Density | 1.217g/cm3 |
| Boiling point | 229.9°C at 760 mmHg |
| Flash point | 89.8°C |
| Refractive index | 1.593 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
18858-05-4 2-chloro-6-methylthiophenol
service@apichina.com