| Product Name | 2-chloro-6-methylpyridine-4-carbonyl chloride |
| CAS No. | 26413-58-1 |
| InChI | InChI=1/C7H5Cl2NO/c1-4-2-5(7(9)11)3-6(8)10-4/h2-3H,1H3 |
| Molecular Formula | C7H5Cl2NO |
| Molecular Weight | 190.0267 |
| Density | 1.384g/cm3 |
| Boiling point | 270.3°C at 760 mmHg |
| Flash point | 117.3°C |
| Refractive index | 1.558 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
26413-58-1 2-chloro-6-methylpyridine-4-carbonyl chloride
service@apichina.com