| Product Name | 2-Chloro-6-methylphenol |
| CAS No. | 87-64-9 |
| Synonyms | 2-Chloro-6-methylphenol,98%; 6-Chloro-o-cresol (OH=1); 6-Chloro-o-cresol |
| InChI | InChI=1/C7H7ClO/c1-5-3-2-4-6(8)7(5)9/h2-4,9H,1H3 |
| Molecular Formula | C7H7ClO |
| Molecular Weight | 142.5829 |
| Density | 1.228g/cm3 |
| Boiling point | 200.4°C at 760 mmHg |
| Flash point | 75°C |
| Refractive index | 1.565 |
| Risk Codes | R21/22:Harmful in contact with skin and if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28:After contact with skin, wash immediately with plenty of ...; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
87-64-9 2-chloro-6-methylphenol
service@apichina.com
- Next：87-65-0 2,6-dichlorophenol
- Previous：87-63-8 2-chloro-6-methylaniline