| Product Name | 2-Chloro-6-Methylbenzoic Acid |
| CAS No. | 21327-86-6 |
| Synonyms | 6-Chloro-o-toluic acid (COOH=1); 6-Chloro-o-toluic acid; Benzoic acid,2-chloro-6-methyl-; 2-Choro-6-methyl-benzoic acid |
| InChI | InChI=1/C8H7ClO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| Molecular Formula | C8H7ClO2 |
| Molecular Weight | 170.593 |
| Density | 1.31g/cm3 |
| Boiling point | 289.9°C at 760 mmHg |
| Flash point | 129.2°C |
| Refractive index | 1.573 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
21327-86-6 2-chloro-6-methylbenzoic acid
service@apichina.com