| Product Name | 2-Chloro-6-iodotoluene |
| CAS No. | 42048-11-3 |
| Synonyms | 1-Chloro-3-iodo-2-methylbenzene; 2-Iodo-6-chlorotoluene |
| InChI | InChI=1/C7H6ClI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| Molecular Formula | C7H6ClI |
| Molecular Weight | 252.48 |
| Density | 1.806g/cm3 |
| Boiling point | 243°C at 760 mmHg |
| Flash point | 100.8°C |
| Refractive index | 1.616 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
42048-11-3 2-chloro-6-iodotoluene
service@apichina.com