| Product Name | 2-chloro-6-fluorobenzylmercaptan |
| CAS No. | 170924-52-4 |
| Synonyms | 2-Chloro-6-fluorobenzylthiol; (2-Chloro-6-fluorophenyl)methanethiol |
| InChI | InChI=1/C7H6ClFS/c8-6-2-1-3-7(9)5(6)4-10/h1-3,10H,4H2 |
| Molecular Formula | C7H6ClFS |
| Molecular Weight | 176.6389 |
| Density | 1.299g/cm3 |
| Boiling point | 227.8°C at 760 mmHg |
| Flash point | 91.6°C |
| Refractive index | 1.559 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
170924-52-4 2-chloro-6-fluorobenzylmercaptan
service@apichina.com