| Product Name | 2-Chloro-6-fluorobenzylamine |
| CAS No. | 15205-15-9 |
| Synonyms | 1-(2-chloro-6-fluorophenyl)methanamine; (2-chloro-6-fluorophenyl)methanaminium; (2-Chloro-6-fluorophenyl)methanamine; 2-Chloro-6-fluorobenzyl amine |
| InChI | InChI=1/C7H7ClFN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H,4,10H2/p+1 |
| Molecular Formula | C7H8ClFN |
| Molecular Weight | 160.596 |
| Boiling point | 211.1°C at 760 mmHg |
| Flash point | 81.5°C |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
15205-15-9 2-chloro-6-fluorobenzylamine
service@apichina.com