| Product Name | 2-Chloro-6-fluoroacetophenone |
| CAS No. | 87327-69-3 |
| Synonyms | 1-(2-chloro-6-fluorophenyl)ethanone; 2'-Chloro-6'-fluoroacetophenone |
| InChI | InChI=1/C8H6ClFO/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3 |
| Molecular Formula | C8H6ClFO |
| Molecular Weight | 172.584 |
| Density | 1.258g/cm3 |
| Boiling point | 191.8°C at 760 mmHg |
| Flash point | 69.8°C |
| Refractive index | 1.512 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
87327-69-3 2-chloro-6-fluoroacetophenone
service@apichina.com