| Product Name | 2-Chloro-6-fluoro-3-methylbenzyl alcohol |
| CAS No. | 261762-83-8 |
| Synonyms | (2-chloro-6-fluoro-3-methylphenyl)methanol |
| InChI | InChI=1/C8H8ClFO/c1-5-2-3-7(10)6(4-11)8(5)9/h2-3,11H,4H2,1H3 |
| Molecular Formula | C8H8ClFO |
| Molecular Weight | 174.5999 |
| Density | 1.286g/cm3 |
| Boiling point | 245.7°C at 760 mmHg |
| Flash point | 102.4°C |
| Refractive index | 1.537 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
261762-83-8 2-chloro-6-fluoro-3-methylbenzyl alcohol
service@apichina.com