| Product Name | 2-Chloro-5-nitrophenyl isocyanate |
| CAS No. | 68622-16-2 |
| Synonyms | 1-chloro-2-isocyanato-4-nitrobenzene |
| InChI | InChI=1/C7H3ClN2O3/c8-6-2-1-5(10(12)13)3-7(6)9-4-11/h1-3H |
| Molecular Formula | C7H3ClN2O3 |
| Molecular Weight | 198.5633 |
| Density | 1.48g/cm3 |
| Melting point | 94-96℃ |
| Boiling point | 286.7°C at 760 mmHg |
| Flash point | 127.2°C |
| Refractive index | 1.612 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42/43:May cause sensitization by inhalation and skin contact.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
68622-16-2 2-chloro-5-nitrophenyl isocyanate
service@apichina.com