| Product Name | 2-Chloro-5-nitrobenzyl alcohol |
| CAS No. | 80866-80-4 |
| Synonyms | (2-chloro-5-nitrophenyl)methanol |
| InChI | InChI=1/C7H6ClNO3/c8-7-2-1-6(9(11)12)3-5(7)4-10/h1-3,10H,4H2 |
| Molecular Formula | C7H6ClNO3 |
| Molecular Weight | 187.5804 |
| Density | 1.476g/cm3 |
| Melting point | 74-79℃ |
| Boiling point | 344.1°C at 760 mmHg |
| Flash point | 161.9°C |
| Refractive index | 1.611 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
80866-80-4 2-chloro-5-nitrobenzyl alcohol
service@apichina.com