| Product Name | 2-Chloro-5-nitrobenzoic acid sodium salt |
| CAS No. | 14667-59-5 |
| Synonyms | Sodium 2-chloro-5-nitrobenzoate |
| InChI | InChI=1/C7H4ClNO4.Na/c8-6-2-1-4(9(12)13)3-5(6)7(10)11;/h1-3H,(H,10,11);/q;+1/p-1 |
| Molecular Formula | C7H3ClNNaO4 |
| Molecular Weight | 223.5458 |
| Boiling point | 356.5°C at 760 mmHg |
| Flash point | 169.4°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
14667-59-5 2-chloro-5-nitrobenzoic acid sodium salt
service@apichina.com